C14H17N3O3 — CID 60850506
4-amino-N-(2-oxo-3H-1,3-benzoxazol-5-yl)cyclohexane-1-carboxamide (PubChem CID 60850506) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is 4-amino-N-(2-oxo-3H-1,3-benzoxazol-5-yl)cyclohexane-1-carboxamide.
| Compound Name | 4-amino-N-(2-oxo-3H-1,3-benzoxazol-5-yl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 60850506 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 4-amino-N-(2-oxo-3H-1,3-benzoxazol-5-yl)cyclohexane-1-carboxamide |
| SMILES | NC1CCC(C(=O)Nc2ccc3oc(=O)[nH]c3c2)CC1 |
| InChI | InChI=1S/C14H17N3O3/c15-9-3-1-8(2-4-9)13(18)16-10-5-6-12-11(7-10)17-14(19)20-12/h5-9H,1-4,15H2,(H,16,18)(H,17,19) |
| InChIKey | XQDUJELDJBZHMF-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 101.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |