C30H24N6O5 — CID 122495102
[(3S,4R)-4-azido-1-[[4-(1-benzofuran-2-yl)isoquinolin-6-yl]methyl]piperidin-3-yl] 4-nitrobenzoate (PubChem CID 122495102) has the molecular formula C30H24N6O5 and a molecular weight of 548.56 g/mol. Its IUPAC name is [(3S,4R)-4-azido-1-[[4-(1-benzofuran-2-yl)isoquinolin-6-yl]methyl]piperidin-3-yl] 4-nitrobenzoate.
| Compound Name | [(3S,4R)-4-azido-1-[[4-(1-benzofuran-2-yl)isoquinolin-6-yl]methyl]piperidin-3-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 122495102 |
| Molecular Formula | C30H24N6O5 |
| Molecular Weight | 548.56 g/mol |
| Exact Mass | 548.18 |
| IUPAC Name | [(3S,4R)-4-azido-1-[[4-(1-benzofuran-2-yl)isoquinolin-6-yl]methyl]piperidin-3-yl] 4-nitrobenzoate |
| SMILES | [N-]=[N+]=N[C@@H]1CCN(Cc2ccc3cncc(-c4cc5ccccc5o4)c3c2)C[C@@H]1OC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C30H24N6O5/c31-34-33-26-11-12-35(18-29(26)41-30(37)20-7-9-23(10-8-20)36(38)39)17-19-5-6-22-15-32-16-25(24(22)13-19)28-14-21-3-1-2-4-27(21)40-28/h1-10,13-16,26,29H,11-12,17-18H2/t26-,29+/m1/s1 |
| InChIKey | DKHVXMJPCZHOLC-UHSQPCAPSA-N |
| XLogP | 6.67 |
| TPSA | 147.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.56 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|