C26H24N4O4 — CID 142459110
4-nitro-N-[2-[6-(piperazin-1-ylmethyl)-1-benzofuran-2-yl]phenyl]benzamide (PubChem CID 142459110) has the molecular formula C26H24N4O4 and a molecular weight of 456.50 g/mol. Its IUPAC name is 4-nitro-N-[2-[6-(piperazin-1-ylmethyl)-1-benzofuran-2-yl]phenyl]benzamide.
| Compound Name | 4-nitro-N-[2-[6-(piperazin-1-ylmethyl)-1-benzofuran-2-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 142459110 |
| Molecular Formula | C26H24N4O4 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | 4-nitro-N-[2-[6-(piperazin-1-ylmethyl)-1-benzofuran-2-yl]phenyl]benzamide |
| SMILES | O=C(Nc1ccccc1-c1cc2ccc(CN3CCNCC3)cc2o1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H24N4O4/c31-26(19-7-9-21(10-8-19)30(32)33)28-23-4-2-1-3-22(23)25-16-20-6-5-18(15-24(20)34-25)17-29-13-11-27-12-14-29/h1-10,15-16,27H,11-14,17H2,(H,28,31) |
| InChIKey | ZBEVILWEXUPZDY-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 100.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|