C21H26BrN3O4 — CID 159162977
tert-butyl 2-[1-[(4-bromo-7-nitroisoquinolin-6-yl)methyl]piperidin-4-yl]acetate (PubChem CID 159162977) has the molecular formula C21H26BrN3O4 and a molecular weight of 464.36 g/mol. Its IUPAC name is tert-butyl 2-[1-[(4-bromo-7-nitroisoquinolin-6-yl)methyl]piperidin-4-yl]acetate.
| Compound Name | tert-butyl 2-[1-[(4-bromo-7-nitroisoquinolin-6-yl)methyl]piperidin-4-yl]acetate |
|---|---|
| PubChem CID | 159162977 |
| Molecular Formula | C21H26BrN3O4 |
| Molecular Weight | 464.36 g/mol |
| Exact Mass | 463.11 |
| IUPAC Name | tert-butyl 2-[1-[(4-bromo-7-nitroisoquinolin-6-yl)methyl]piperidin-4-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CC1CCN(Cc2cc3c(Br)cncc3cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C21H26BrN3O4/c1-21(2,3)29-20(26)8-14-4-6-24(7-5-14)13-16-9-17-15(10-19(16)25(27)28)11-23-12-18(17)22/h9-12,14H,4-8,13H2,1-3H3 |
| InChIKey | MWPBHWXSPBRBNN-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 85.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.36 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|