C18H10F3NO3S — CID 122495177
[4-(1-benzofuran-2-yl)isoquinolin-6-yl] (S)-trifluoromethanesulfinate (PubChem CID 122495177) has the molecular formula C18H10F3NO3S and a molecular weight of 377.34 g/mol. Its IUPAC name is [4-(1-benzofuran-2-yl)isoquinolin-6-yl] (S)-trifluoromethanesulfinate.
| Compound Name | [4-(1-benzofuran-2-yl)isoquinolin-6-yl] (S)-trifluoromethanesulfinate |
|---|---|
| PubChem CID | 122495177 |
| Molecular Formula | C18H10F3NO3S |
| Molecular Weight | 377.34 g/mol |
| Exact Mass | 377.03 |
| IUPAC Name | [4-(1-benzofuran-2-yl)isoquinolin-6-yl] (S)-trifluoromethanesulfinate |
| SMILES | O=[S@@](Oc1ccc2cncc(-c3cc4ccccc4o3)c2c1)C(F)(F)F |
| InChI | InChI=1S/C18H10F3NO3S/c19-18(20,21)26(23)25-13-6-5-12-9-22-10-15(14(12)8-13)17-7-11-3-1-2-4-16(11)24-17/h1-10H/t26-/m0/s1 |
| InChIKey | WLRKLVNZXSTCKN-SANMLTNESA-N |
| XLogP | 5.21 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.34 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |