C30H32N4O2 — CID 122495789
[4-(4-aminophenyl)-1-phenyl-4a,5,6,7,8,9,10,10a-octahydrocycloocta[d]pyridazin-5-yl] N-benzylcarbamate (PubChem CID 122495789) has the molecular formula C30H32N4O2 and a molecular weight of 480.61 g/mol. Its IUPAC name is [4-(4-aminophenyl)-1-phenyl-4a,5,6,7,8,9,10,10a-octahydrocycloocta[d]pyridazin-5-yl] N-benzylcarbamate.
| Compound Name | [4-(4-aminophenyl)-1-phenyl-4a,5,6,7,8,9,10,10a-octahydrocycloocta[d]pyridazin-5-yl] N-benzylcarbamate |
|---|---|
| PubChem CID | 122495789 |
| Molecular Formula | C30H32N4O2 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.25 |
| IUPAC Name | [4-(4-aminophenyl)-1-phenyl-4a,5,6,7,8,9,10,10a-octahydrocycloocta[d]pyridazin-5-yl] N-benzylcarbamate |
| SMILES | Nc1ccc(C2=NN=C(c3ccccc3)C3CCCCCC(OC(=O)NCc4ccccc4)C23)cc1 |
| InChI | InChI=1S/C30H32N4O2/c31-24-18-16-23(17-19-24)29-27-25(28(33-34-29)22-12-6-2-7-13-22)14-8-3-9-15-26(27)36-30(35)32-20-21-10-4-1-5-11-21/h1-2,4-7,10-13,16-19,25-27H,3,8-9,14-15,20,31H2,(H,32,35) |
| InChIKey | CBDUFWLOBMXNTF-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|