C14H30O2 — CID 122497763
3-(2-ethyl-3,4,5-trimethylhexoxy)propan-1-ol (PubChem CID 122497763) has the molecular formula C14H30O2 and a molecular weight of 230.39 g/mol. Its IUPAC name is 3-(2-ethyl-3,4,5-trimethylhexoxy)propan-1-ol.
| Compound Name | 3-(2-ethyl-3,4,5-trimethylhexoxy)propan-1-ol |
|---|---|
| PubChem CID | 122497763 |
| Molecular Formula | C14H30O2 |
| Molecular Weight | 230.39 g/mol |
| Exact Mass | 230.22 |
| IUPAC Name | 3-(2-ethyl-3,4,5-trimethylhexoxy)propan-1-ol |
| SMILES | CCC(COCCCO)C(C)C(C)C(C)C |
| InChI | InChI=1S/C14H30O2/c1-6-14(10-16-9-7-8-15)13(5)12(4)11(2)3/h11-15H,6-10H2,1-5H3 |
| InChIKey | FAECVKUOAMODJO-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.39 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|