C20H25NO4 — CID 122498168
(4R,7aR,12bS)-9-methoxy-3-methylspiro[1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-7,2'-1,3-dioxolane] (PubChem CID 122498168) has the molecular formula C20H25NO4 and a molecular weight of 343.42 g/mol. Its IUPAC name is (4R,7aR,12bS)-9-methoxy-3-methylspiro[1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-7,2'-1,3-dioxolane].
| Compound Name | (4R,7aR,12bS)-9-methoxy-3-methylspiro[1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-7,2'-1,3-dioxolane] |
|---|---|
| PubChem CID | 122498168 |
| Molecular Formula | C20H25NO4 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | (4R,7aR,12bS)-9-methoxy-3-methylspiro[1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-7,2'-1,3-dioxolane] |
| SMILES | COc1ccc2c3c1O[C@H]1C4(CCC5[C@@H](C2)N(C)CC[C@@]351)OCCO4 |
| InChI | InChI=1S/C20H25NO4/c1-21-8-7-19-13-5-6-20(23-9-10-24-20)18(19)25-17-15(22-2)4-3-12(16(17)19)11-14(13)21/h3-4,13-14,18H,5-11H2,1-2H3/t13?,14-,18-,19+/m1/s1 |
| InChIKey | MWBQUTDEFNFIAI-SLHDDKBHSA-N |
| XLogP | 2.11 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |