C24H29N3O3 — CID 122498194
N-methyl-6-[6-[(2R)-2-(oxan-2-yloxy)butoxy]quinolin-2-yl]pyridin-3-amine (PubChem CID 122498194) has the molecular formula C24H29N3O3 and a molecular weight of 407.51 g/mol. Its IUPAC name is N-methyl-6-[6-[(2R)-2-(oxan-2-yloxy)butoxy]quinolin-2-yl]pyridin-3-amine.
| Compound Name | N-methyl-6-[6-[(2R)-2-(oxan-2-yloxy)butoxy]quinolin-2-yl]pyridin-3-amine |
|---|---|
| PubChem CID | 122498194 |
| Molecular Formula | C24H29N3O3 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | N-methyl-6-[6-[(2R)-2-(oxan-2-yloxy)butoxy]quinolin-2-yl]pyridin-3-amine |
| SMILES | CC[C@H](COc1ccc2nc(-c3ccc(NC)cn3)ccc2c1)OC1CCCCO1 |
| InChI | InChI=1S/C24H29N3O3/c1-3-19(30-24-6-4-5-13-28-24)16-29-20-9-12-21-17(14-20)7-10-23(27-21)22-11-8-18(25-2)15-26-22/h7-12,14-15,19,24-25H,3-6,13,16H2,1-2H3/t19-,24?/m1/s1 |
| InChIKey | LGRVPUDTTKTPSS-PHSANKKPSA-N |
| XLogP | 5.04 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |