C25H28IN3O4S2 — CID 144649868
[3-[[2-[(1E,3E)-4-[6-(methylamino)-3-pyridinyl]buta-1,3-dienyl]-1,3-benzothiazol-6-yl]oxy]-2-(oxan-2-yloxy)propoxy] thiohypoiodite (PubChem CID 144649868) has the molecular formula C25H28IN3O4S2 and a molecular weight of 625.55 g/mol. Its IUPAC name is [3-[[2-[(1E,3E)-4-[6-(methylamino)-3-pyridinyl]buta-1,3-dienyl]-1,3-benzothiazol-6-yl]oxy]-2-(oxan-2-yloxy)propoxy] thiohypoiodite.
| Compound Name | [3-[[2-[(1E,3E)-4-[6-(methylamino)-3-pyridinyl]buta-1,3-dienyl]-1,3-benzothiazol-6-yl]oxy]-2-(oxan-2-yloxy)propoxy] thiohypoiodite |
|---|---|
| PubChem CID | 144649868 |
| Molecular Formula | C25H28IN3O4S2 |
| Molecular Weight | 625.55 g/mol |
| Exact Mass | 625.06 |
| IUPAC Name | [3-[[2-[(1E,3E)-4-[6-(methylamino)-3-pyridinyl]buta-1,3-dienyl]-1,3-benzothiazol-6-yl]oxy]-2-(oxan-2-yloxy)propoxy] thiohypoiodite |
| SMILES | CNc1ccc(/C=C/C=C/c2nc3ccc(OCC(COSI)OC4CCCCO4)cc3s2)cn1 |
| InChI | InChI=1S/C25H28IN3O4S2/c1-27-23-12-9-18(15-28-23)6-2-3-7-24-29-21-11-10-19(14-22(21)34-24)31-16-20(17-32-35-26)33-25-8-4-5-13-30-25/h2-3,6-7,9-12,14-15,20,25H,4-5,8,13,16-17H2,1H3,(H,27,28)/b6-2+,7-3+ |
| InChIKey | PRHGAJLTHWXUAB-YPCIICBESA-N |
| XLogP | 6.76 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.55 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|