C13H18BrF5O5 — CID 122498779
2,2,4,4,4-pentafluorobutyl 2-[(2-bromo-2-methylpropanoyl)oxymethyl]-3-hydroxy-2-methylpropanoate (PubChem CID 122498779) has the molecular formula C13H18BrF5O5 and a molecular weight of 429.18 g/mol. Its IUPAC name is 2,2,4,4,4-pentafluorobutyl 2-[(2-bromo-2-methylpropanoyl)oxymethyl]-3-hydroxy-2-methylpropanoate.
| Compound Name | 2,2,4,4,4-pentafluorobutyl 2-[(2-bromo-2-methylpropanoyl)oxymethyl]-3-hydroxy-2-methylpropanoate |
|---|---|
| PubChem CID | 122498779 |
| Molecular Formula | C13H18BrF5O5 |
| Molecular Weight | 429.18 g/mol |
| Exact Mass | 428.03 |
| IUPAC Name | 2,2,4,4,4-pentafluorobutyl 2-[(2-bromo-2-methylpropanoyl)oxymethyl]-3-hydroxy-2-methylpropanoate |
| SMILES | CC(C)(Br)C(=O)OCC(C)(CO)C(=O)OCC(F)(F)CC(F)(F)F |
| InChI | InChI=1S/C13H18BrF5O5/c1-10(2,14)8(21)23-6-11(3,5-20)9(22)24-7-12(15,16)4-13(17,18)19/h20H,4-7H2,1-3H3 |
| InChIKey | UHMXHDULNVIJLD-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.18 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|