C12H15N3O2 — CID 122499525
2-amino-3-(7-amino-2-methyl-1H-indol-3-yl)propanoic acid (PubChem CID 122499525) has the molecular formula C12H15N3O2 and a molecular weight of 233.27 g/mol. Its IUPAC name is 2-amino-3-(7-amino-2-methyl-1H-indol-3-yl)propanoic acid.
| Compound Name | 2-amino-3-(7-amino-2-methyl-1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 122499525 |
| Molecular Formula | C12H15N3O2 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 2-amino-3-(7-amino-2-methyl-1H-indol-3-yl)propanoic acid |
| SMILES | Cc1[nH]c2c(N)cccc2c1CC(N)C(=O)O |
| InChI | InChI=1S/C12H15N3O2/c1-6-8(5-10(14)12(16)17)7-3-2-4-9(13)11(7)15-6/h2-4,10,15H,5,13-14H2,1H3,(H,16,17) |
| InChIKey | LAXZLHCTSOPREO-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 105.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|