C11H19N3O5 — CID 122511081
[(2R,3S)-3-amino-4-(2-aminoacetyl)oxy-4-oxobutan-2-yl] (2S)-pyrrolidine-2-carboxylate (PubChem CID 122511081) has the molecular formula C11H19N3O5 and a molecular weight of 273.29 g/mol. Its IUPAC name is [(2R,3S)-3-amino-4-(2-aminoacetyl)oxy-4-oxobutan-2-yl] (2S)-pyrrolidine-2-carboxylate.
| Compound Name | [(2R,3S)-3-amino-4-(2-aminoacetyl)oxy-4-oxobutan-2-yl] (2S)-pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 122511081 |
| Molecular Formula | C11H19N3O5 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | [(2R,3S)-3-amino-4-(2-aminoacetyl)oxy-4-oxobutan-2-yl] (2S)-pyrrolidine-2-carboxylate |
| SMILES | C[C@@H](OC(=O)[C@@H]1CCCN1)[C@H](N)C(=O)OC(=O)CN |
| InChI | InChI=1S/C11H19N3O5/c1-6(9(13)11(17)19-8(15)5-12)18-10(16)7-3-2-4-14-7/h6-7,9,14H,2-5,12-13H2,1H3/t6-,7+,9+/m1/s1 |
| InChIKey | ZMCVVHRLHQFWCM-FJXKBIBVSA-N |
| XLogP | -1.97 |
| TPSA | 133.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|