C15H25N3O5 — CID 87070196
[(2S)-2-amino-3-methylbutanoyl] (2S)-1-[(2S)-pyrrolidine-2-carbonyl]oxypyrrolidine-2-carboxylate (PubChem CID 87070196) has the molecular formula C15H25N3O5 and a molecular weight of 327.38 g/mol. Its IUPAC name is [(2S)-2-amino-3-methylbutanoyl] (2S)-1-[(2S)-pyrrolidine-2-carbonyl]oxypyrrolidine-2-carboxylate.
| Compound Name | [(2S)-2-amino-3-methylbutanoyl] (2S)-1-[(2S)-pyrrolidine-2-carbonyl]oxypyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 87070196 |
| Molecular Formula | C15H25N3O5 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | [(2S)-2-amino-3-methylbutanoyl] (2S)-1-[(2S)-pyrrolidine-2-carbonyl]oxypyrrolidine-2-carboxylate |
| SMILES | CC(C)[C@H](N)C(=O)OC(=O)[C@@H]1CCCN1OC(=O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C15H25N3O5/c1-9(2)12(16)15(21)22-14(20)11-6-4-8-18(11)23-13(19)10-5-3-7-17-10/h9-12,17H,3-8,16H2,1-2H3/t10-,11-,12-/m0/s1 |
| InChIKey | RFAIGZKDFSDBJF-SRVKXCTJSA-N |
| XLogP | -0.29 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|