C11H17N3O4 — CID 87975770
carbamoyl (2S)-1-[(2S)-pyrrolidine-2-carbonyl]pyrrolidine-2-carboxylate (PubChem CID 87975770) has the molecular formula C11H17N3O4 and a molecular weight of 255.27 g/mol. Its IUPAC name is carbamoyl (2S)-1-[(2S)-pyrrolidine-2-carbonyl]pyrrolidine-2-carboxylate.
| Compound Name | carbamoyl (2S)-1-[(2S)-pyrrolidine-2-carbonyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 87975770 |
| Molecular Formula | C11H17N3O4 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | carbamoyl (2S)-1-[(2S)-pyrrolidine-2-carbonyl]pyrrolidine-2-carboxylate |
| SMILES | NC(=O)OC(=O)[C@@H]1CCCN1C(=O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C11H17N3O4/c12-11(17)18-10(16)8-4-2-6-14(8)9(15)7-3-1-5-13-7/h7-8,13H,1-6H2,(H2,12,17)/t7-,8-/m0/s1 |
| InChIKey | XKFCFOQWWBLCEF-YUMQZZPRSA-N |
| XLogP | -0.65 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|