C25H42N6O8 — CID 69430454
pentanedioic acid;bis(1-[(2S)-pyrrolidine-2-carbonyl]pyrrolidine-2-carboxamide) (PubChem CID 69430454) has the molecular formula C25H42N6O8 and a molecular weight of 554.65 g/mol. Its IUPAC name is pentanedioic acid;bis(1-[(2S)-pyrrolidine-2-carbonyl]pyrrolidine-2-carboxamide).
| Compound Name | pentanedioic acid;bis(1-[(2S)-pyrrolidine-2-carbonyl]pyrrolidine-2-carboxamide) |
|---|---|
| PubChem CID | 69430454 |
| Molecular Formula | C25H42N6O8 |
| Molecular Weight | 554.65 g/mol |
| Exact Mass | 554.31 |
| IUPAC Name | pentanedioic acid;bis(1-[(2S)-pyrrolidine-2-carbonyl]pyrrolidine-2-carboxamide) |
| SMILES | NC(=O)C1CCCN1C(=O)[C@@H]1CCCN1.NC(=O)C1CCCN1C(=O)[C@@H]1CCCN1.O=C(O)CCCC(=O)O |
| InChI | InChI=1S/2C10H17N3O2.C5H8O4/c2*11-9(14)8-4-2-6-13(8)10(15)7-3-1-5-12-7;6-4(7)2-1-3-5(8)9/h2*7-8,12H,1-6H2,(H2,11,14);1-3H2,(H,6,7)(H,8,9)/t2*7-,8?;/m00./s1 |
| InChIKey | QAGZSDRPDNJLFP-CNLMZSPQSA-N |
| XLogP | -1.24 |
| TPSA | 225.46 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.65 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |