C12H16N2O9 — CID 87758528
1-[4-(azetidine-2-carbonyloxy)-2,3-dihydroxy-4-oxobutanoyl]oxyazetidine-2-carboxylic acid (PubChem CID 87758528) has the molecular formula C12H16N2O9 and a molecular weight of 332.27 g/mol. Its IUPAC name is 1-[4-(azetidine-2-carbonyloxy)-2,3-dihydroxy-4-oxobutanoyl]oxyazetidine-2-carboxylic acid.
| Compound Name | 1-[4-(azetidine-2-carbonyloxy)-2,3-dihydroxy-4-oxobutanoyl]oxyazetidine-2-carboxylic acid |
|---|---|
| PubChem CID | 87758528 |
| Molecular Formula | C12H16N2O9 |
| Molecular Weight | 332.27 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 1-[4-(azetidine-2-carbonyloxy)-2,3-dihydroxy-4-oxobutanoyl]oxyazetidine-2-carboxylic acid |
| SMILES | O=C(OC(=O)C(O)C(O)C(=O)ON1CCC1C(=O)O)C1CCN1 |
| InChI | InChI=1S/C12H16N2O9/c15-7(11(20)22-10(19)5-1-3-13-5)8(16)12(21)23-14-4-2-6(14)9(17)18/h5-8,13,15-16H,1-4H2,(H,17,18) |
| InChIKey | GULIVSPPNUOOPJ-UHFFFAOYSA-N |
| XLogP | -3.24 |
| TPSA | 162.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.27 |
| LogP ≤ 5 | -3.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|