C9H17N2O7P — CID 54516256
(2S,3R)-2-amino-3-[hydroxy-[(2S)-pyrrolidine-2-carbonyl]oxyphosphoryl]oxybutanoic acid (PubChem CID 54516256) has the molecular formula C9H17N2O7P and a molecular weight of 296.22 g/mol. Its IUPAC name is (2S,3R)-2-amino-3-[hydroxy-[(2S)-pyrrolidine-2-carbonyl]oxyphosphoryl]oxybutanoic acid.
| Compound Name | (2S,3R)-2-amino-3-[hydroxy-[(2S)-pyrrolidine-2-carbonyl]oxyphosphoryl]oxybutanoic acid |
|---|---|
| PubChem CID | 54516256 |
| Molecular Formula | C9H17N2O7P |
| Molecular Weight | 296.22 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | (2S,3R)-2-amino-3-[hydroxy-[(2S)-pyrrolidine-2-carbonyl]oxyphosphoryl]oxybutanoic acid |
| SMILES | C[C@@H](OP(=O)(O)OC(=O)[C@@H]1CCCN1)[C@H](N)C(=O)O |
| InChI | InChI=1S/C9H17N2O7P/c1-5(7(10)8(12)13)17-19(15,16)18-9(14)6-3-2-4-11-6/h5-7,11H,2-4,10H2,1H3,(H,12,13)(H,15,16)/t5-,6+,7+/m1/s1 |
| InChIKey | YMPVXEOHKKEYDN-VQVTYTSYSA-N |
| XLogP | -0.80 |
| TPSA | 148.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.22 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|