C13H17O6P — CID 122512542
5-(dimethylphosphorylmethoxy)-2,4-dimethylbenzene-1,3-dicarboxylic acid (PubChem CID 122512542) has the molecular formula C13H17O6P and a molecular weight of 300.25 g/mol. Its IUPAC name is 5-(dimethylphosphorylmethoxy)-2,4-dimethylbenzene-1,3-dicarboxylic acid.
| Compound Name | 5-(dimethylphosphorylmethoxy)-2,4-dimethylbenzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 122512542 |
| Molecular Formula | C13H17O6P |
| Molecular Weight | 300.25 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 5-(dimethylphosphorylmethoxy)-2,4-dimethylbenzene-1,3-dicarboxylic acid |
| SMILES | Cc1c(OCP(C)(C)=O)cc(C(=O)O)c(C)c1C(=O)O |
| InChI | InChI=1S/C13H17O6P/c1-7-9(12(14)15)5-10(19-6-20(3,4)18)8(2)11(7)13(16)17/h5H,6H2,1-4H3,(H,14,15)(H,16,17) |
| InChIKey | WWWHDWIBICVUNI-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.25 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|