C19H14FN3O3S — CID 122514095
2-(2-fluorophenyl)-N-[2-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]-1,3-thiazole-5-carboxamide (PubChem CID 122514095) has the molecular formula C19H14FN3O3S and a molecular weight of 383.40 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-N-[2-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]-1,3-thiazole-5-carboxamide.
| Compound Name | 2-(2-fluorophenyl)-N-[2-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 122514095 |
| Molecular Formula | C19H14FN3O3S |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | 2-(2-fluorophenyl)-N-[2-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]-1,3-thiazole-5-carboxamide |
| SMILES | O=C(/C=C/c1ccccc1NC(=O)c1cnc(-c2ccccc2F)s1)NO |
| InChI | InChI=1S/C19H14FN3O3S/c20-14-7-3-2-6-13(14)19-21-11-16(27-19)18(25)22-15-8-4-1-5-12(15)9-10-17(24)23-26/h1-11,26H,(H,22,25)(H,23,24)/b10-9+ |
| InChIKey | FXDVEDOCLQWYBN-MDZDMXLPSA-N |
| XLogP | 3.72 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|