C20H15F3N4O3 — CID 122514217
N-[2-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]-1-[2-(trifluoromethyl)phenyl]imidazole-2-carboxamide (PubChem CID 122514217) has the molecular formula C20H15F3N4O3 and a molecular weight of 416.36 g/mol. Its IUPAC name is N-[2-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]-1-[2-(trifluoromethyl)phenyl]imidazole-2-carboxamide.
| Compound Name | N-[2-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]-1-[2-(trifluoromethyl)phenyl]imidazole-2-carboxamide |
|---|---|
| PubChem CID | 122514217 |
| Molecular Formula | C20H15F3N4O3 |
| Molecular Weight | 416.36 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | N-[2-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]-1-[2-(trifluoromethyl)phenyl]imidazole-2-carboxamide |
| SMILES | O=C(/C=C/c1ccccc1NC(=O)c1nccn1-c1ccccc1C(F)(F)F)NO |
| InChI | InChI=1S/C20H15F3N4O3/c21-20(22,23)14-6-2-4-8-16(14)27-12-11-24-18(27)19(29)25-15-7-3-1-5-13(15)9-10-17(28)26-30/h1-12,30H,(H,25,29)(H,26,28)/b10-9+ |
| InChIKey | VLMQWIMNUKIUKI-MDZDMXLPSA-N |
| XLogP | 3.66 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.36 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|