About ethyl 2-(2-ethoxycarbonyloxyethyl)-2,4-dimethylpentanoate
ethyl 2-(2-ethoxycarbonyloxyethyl)-2,4-dimethylpentanoate (PubChem CID 122517263) has the molecular formula C14H26O5
and a molecular weight of 274.36 g/mol. Its IUPAC name is ethyl 2-(2-ethoxycarbonyloxyethyl)-2,4-dimethylpentanoate.
Analyze ethyl 2-(2-ethoxycarbonyloxyethyl)-2,4-dimethylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(2-ethoxycarbonyloxyethyl)-2,4-dimethylpentanoate?
The IUPAC name of ethyl 2-(2-ethoxycarbonyloxyethyl)-2,4-dimethylpentanoate (CID 122517263) is ethyl 2-(2-ethoxycarbonyloxyethyl)-2,4-dimethylpentanoate.
What is the SMILES notation for ethyl 2-(2-ethoxycarbonyloxyethyl)-2,4-dimethylpentanoate?
The canonical SMILES for ethyl 2-(2-ethoxycarbonyloxyethyl)-2,4-dimethylpentanoate is CCOC(=O)OCCC(C)(CC(C)C)C(=O)OCC.
What is the InChIKey of ethyl 2-(2-ethoxycarbonyloxyethyl)-2,4-dimethylpentanoate?
The InChIKey is JHHAZNMRUXGZBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O5/c1-6-17-12(15)14(5,10-11(3)4)8-9-19-13(16)18-7-2/h11H,6-10H2,1-5H3.
What are the key properties of ethyl 2-(2-ethoxycarbonyloxyethyl)-2,4-dimethylpentanoate?
ethyl 2-(2-ethoxycarbonyloxyethyl)-2,4-dimethylpentanoate has a molecular weight of 274.36 g/mol, XLogP of 3.17, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(2-ethoxycarbonyloxyethyl)-2,4-dimethylpentanoate is sourced from PubChem (CID 122517263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).