C19H24ClFN8O — CID 122518641
(2R)-2-[[[2-(5-chloro-7,7a-dihydro-1H-pyrrolo[2,3-b]pyridin-3-yl)-5-fluoropyrimidin-4-yl]amino]methyl]-N-methylpiperidine-1-carbohydrazide (PubChem CID 122518641) has the molecular formula C19H24ClFN8O and a molecular weight of 434.91 g/mol. Its IUPAC name is (2R)-2-[[[2-(5-chloro-7,7a-dihydro-1H-pyrrolo[2,3-b]pyridin-3-yl)-5-fluoropyrimidin-4-yl]amino]methyl]-N-methylpiperidine-1-carbohydrazide.
| Compound Name | (2R)-2-[[[2-(5-chloro-7,7a-dihydro-1H-pyrrolo[2,3-b]pyridin-3-yl)-5-fluoropyrimidin-4-yl]amino]methyl]-N-methylpiperidine-1-carbohydrazide |
|---|---|
| PubChem CID | 122518641 |
| Molecular Formula | C19H24ClFN8O |
| Molecular Weight | 434.91 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | (2R)-2-[[[2-(5-chloro-7,7a-dihydro-1H-pyrrolo[2,3-b]pyridin-3-yl)-5-fluoropyrimidin-4-yl]amino]methyl]-N-methylpiperidine-1-carbohydrazide |
| SMILES | CN(N)C(=O)N1CCCC[C@@H]1CNc1nc(C2=CNC3NC=C(Cl)C=C23)ncc1F |
| InChI | InChI=1S/C19H24ClFN8O/c1-28(22)19(30)29-5-3-2-4-12(29)8-24-18-15(21)10-26-17(27-18)14-9-25-16-13(14)6-11(20)7-23-16/h6-7,9-10,12,16,23,25H,2-5,8,22H2,1H3,(H,24,26,27)/t12-,16?/m1/s1 |
| InChIKey | GNIWKZJQDPTAIW-ZGTOLYCTSA-N |
| XLogP | 1.69 |
| TPSA | 111.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.91 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|