C18H25FN10O — CID 122518661
(2R)-2-amino-2-[[[2-(1-amino-7,7a-dihydropyrrolo[2,3-b]pyridin-3-yl)-5-fluoropyrimidin-4-yl]amino]methyl]-N-methylpyrrolidine-1-carbohydrazide (PubChem CID 122518661) has the molecular formula C18H25FN10O and a molecular weight of 416.47 g/mol. Its IUPAC name is (2R)-2-amino-2-[[[2-(1-amino-7,7a-dihydropyrrolo[2,3-b]pyridin-3-yl)-5-fluoropyrimidin-4-yl]amino]methyl]-N-methylpyrrolidine-1-carbohydrazide.
| Compound Name | (2R)-2-amino-2-[[[2-(1-amino-7,7a-dihydropyrrolo[2,3-b]pyridin-3-yl)-5-fluoropyrimidin-4-yl]amino]methyl]-N-methylpyrrolidine-1-carbohydrazide |
|---|---|
| PubChem CID | 122518661 |
| Molecular Formula | C18H25FN10O |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | (2R)-2-amino-2-[[[2-(1-amino-7,7a-dihydropyrrolo[2,3-b]pyridin-3-yl)-5-fluoropyrimidin-4-yl]amino]methyl]-N-methylpyrrolidine-1-carbohydrazide |
| SMILES | CN(N)C(=O)N1CCC[C@]1(N)CNc1nc(C2=CN(N)C3NC=CC=C23)ncc1F |
| InChI | InChI=1S/C18H25FN10O/c1-27(21)17(30)28-7-3-5-18(28,20)10-25-15-13(19)8-24-14(26-15)12-9-29(22)16-11(12)4-2-6-23-16/h2,4,6,8-9,16,23H,3,5,7,10,20-22H2,1H3,(H,24,25,26)/t16?,18-/m1/s1 |
| InChIKey | OWDXZKLPMAMDER-UHUGOGIASA-N |
| XLogP | -0.40 |
| TPSA | 154.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|