C17H21ClFN7 — CID 122518837
1-N'-[2-(1-amino-5-chloro-7,7a-dihydropyrrolo[2,3-b]pyridin-3-yl)-5-fluoropyrimidin-4-yl]cyclohexane-1,1-diamine (PubChem CID 122518837) has the molecular formula C17H21ClFN7 and a molecular weight of 377.86 g/mol. Its IUPAC name is 1-N'-[2-(1-amino-5-chloro-7,7a-dihydropyrrolo[2,3-b]pyridin-3-yl)-5-fluoropyrimidin-4-yl]cyclohexane-1,1-diamine.
| Compound Name | 1-N'-[2-(1-amino-5-chloro-7,7a-dihydropyrrolo[2,3-b]pyridin-3-yl)-5-fluoropyrimidin-4-yl]cyclohexane-1,1-diamine |
|---|---|
| PubChem CID | 122518837 |
| Molecular Formula | C17H21ClFN7 |
| Molecular Weight | 377.86 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 1-N'-[2-(1-amino-5-chloro-7,7a-dihydropyrrolo[2,3-b]pyridin-3-yl)-5-fluoropyrimidin-4-yl]cyclohexane-1,1-diamine |
| SMILES | NN1C=C(c2ncc(F)c(NC3(N)CCCCC3)n2)C2=CC(Cl)=CNC21 |
| InChI | InChI=1S/C17H21ClFN7/c18-10-6-11-12(9-26(21)16(11)23-7-10)14-22-8-13(19)15(24-14)25-17(20)4-2-1-3-5-17/h6-9,16,23H,1-5,20-21H2,(H,22,24,25) |
| InChIKey | ULMLANPYWZWKGX-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 105.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.86 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|