C17H19ClFN7O — CID 122518746
(3S)-3-amino-3-[[2-(5-chloro-7,7a-dihydro-1H-pyrrolo[2,3-b]pyridin-3-yl)-5-fluoropyrimidin-4-yl]amino]piperidine-1-carbaldehyde (PubChem CID 122518746) has the molecular formula C17H19ClFN7O and a molecular weight of 391.84 g/mol. Its IUPAC name is (3S)-3-amino-3-[[2-(5-chloro-7,7a-dihydro-1H-pyrrolo[2,3-b]pyridin-3-yl)-5-fluoropyrimidin-4-yl]amino]piperidine-1-carbaldehyde.
| Compound Name | (3S)-3-amino-3-[[2-(5-chloro-7,7a-dihydro-1H-pyrrolo[2,3-b]pyridin-3-yl)-5-fluoropyrimidin-4-yl]amino]piperidine-1-carbaldehyde |
|---|---|
| PubChem CID | 122518746 |
| Molecular Formula | C17H19ClFN7O |
| Molecular Weight | 391.84 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | (3S)-3-amino-3-[[2-(5-chloro-7,7a-dihydro-1H-pyrrolo[2,3-b]pyridin-3-yl)-5-fluoropyrimidin-4-yl]amino]piperidine-1-carbaldehyde |
| SMILES | N[C@]1(Nc2nc(C3=CNC4NC=C(Cl)C=C34)ncc2F)CCCN(C=O)C1 |
| InChI | InChI=1S/C17H19ClFN7O/c18-10-4-11-12(6-22-14(11)21-5-10)15-23-7-13(19)16(24-15)25-17(20)2-1-3-26(8-17)9-27/h4-7,9,14,21-22H,1-3,8,20H2,(H,23,24,25)/t14?,17-/m0/s1 |
| InChIKey | ZTPABDOSKLXKHJ-JRZJBTRGSA-N |
| XLogP | 0.81 |
| TPSA | 108.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.84 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|