C11H8ClF2N5 — CID 122518663
2-(5-chloro-7,7a-dihydro-1H-pyrrolo[2,3-b]pyridin-3-yl)-N,5-difluoropyrimidin-4-amine (PubChem CID 122518663) has the molecular formula C11H8ClF2N5 and a molecular weight of 283.67 g/mol. Its IUPAC name is 2-(5-chloro-7,7a-dihydro-1H-pyrrolo[2,3-b]pyridin-3-yl)-N,5-difluoropyrimidin-4-amine.
| Compound Name | 2-(5-chloro-7,7a-dihydro-1H-pyrrolo[2,3-b]pyridin-3-yl)-N,5-difluoropyrimidin-4-amine |
|---|---|
| PubChem CID | 122518663 |
| Molecular Formula | C11H8ClF2N5 |
| Molecular Weight | 283.67 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | 2-(5-chloro-7,7a-dihydro-1H-pyrrolo[2,3-b]pyridin-3-yl)-N,5-difluoropyrimidin-4-amine |
| SMILES | FNc1nc(C2=CNC3NC=C(Cl)C=C23)ncc1F |
| InChI | InChI=1S/C11H8ClF2N5/c12-5-1-6-7(3-16-9(6)15-2-5)10-17-4-8(13)11(18-10)19-14/h1-4,9,15-16H,(H,17,18,19) |
| InChIKey | XPKHZNIZUUIZBD-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 61.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.67 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|