C26H19FN6 — CID 122519732
4-[[4-amino-8-[4-[(E)-2-cyanoethenyl]-2,6-dimethylphenyl]-6-fluoroquinazolin-2-yl]amino]benzonitrile (PubChem CID 122519732) has the molecular formula C26H19FN6 and a molecular weight of 434.48 g/mol. Its IUPAC name is 4-[[4-amino-8-[4-[(E)-2-cyanoethenyl]-2,6-dimethylphenyl]-6-fluoroquinazolin-2-yl]amino]benzonitrile.
| Compound Name | 4-[[4-amino-8-[4-[(E)-2-cyanoethenyl]-2,6-dimethylphenyl]-6-fluoroquinazolin-2-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 122519732 |
| Molecular Formula | C26H19FN6 |
| Molecular Weight | 434.48 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | 4-[[4-amino-8-[4-[(E)-2-cyanoethenyl]-2,6-dimethylphenyl]-6-fluoroquinazolin-2-yl]amino]benzonitrile |
| SMILES | Cc1cc(/C=C/C#N)cc(C)c1-c1cc(F)cc2c(N)nc(Nc3ccc(C#N)cc3)nc12 |
| InChI | InChI=1S/C26H19FN6/c1-15-10-18(4-3-9-28)11-16(2)23(15)21-12-19(27)13-22-24(21)32-26(33-25(22)30)31-20-7-5-17(14-29)6-8-20/h3-8,10-13H,1-2H3,(H3,30,31,32,33)/b4-3+ |
| InChIKey | TZNCXDDIHGEKIK-ONEGZZNKSA-N |
| XLogP | 5.79 |
| TPSA | 111.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.48 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|