About ethyl 5-oxo-7H-benzimidazolo[1,2-a]quinoline-6-carboxylate
ethyl 5-oxo-7H-benzimidazolo[1,2-a]quinoline-6-carboxylate (PubChem CID 122523532) has the molecular formula C18H14N2O3
and a molecular weight of 306.32 g/mol. Its IUPAC name is ethyl 5-oxo-7H-benzimidazolo[1,2-a]quinoline-6-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-oxo-7H-benzimidazolo[1,2-a]quinoline-6-carboxylate |
| PubChem CID | 122523532 |
| Molecular Formula | C18H14N2O3 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | ethyl 5-oxo-7H-benzimidazolo[1,2-a]quinoline-6-carboxylate |
| SMILES | CCOC(=O)c1c(=O)c2ccccc2n2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C18H14N2O3/c1-2-23-18(22)15-16(21)11-7-3-5-9-13(11)20-14-10-6-4-8-12(14)19-17(15)20/h3-10,19H,2H2,1H3 |
| InChIKey | HGYRCYKLLSGOBI-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 5-oxo-7H-benzimidazolo[1,2-a]quinoline-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-oxo-7H-benzimidazolo[1,2-a]quinoline-6-carboxylate?
The IUPAC name of ethyl 5-oxo-7H-benzimidazolo[1,2-a]quinoline-6-carboxylate (CID 122523532) is ethyl 5-oxo-7H-benzimidazolo[1,2-a]quinoline-6-carboxylate.
What is the SMILES notation for ethyl 5-oxo-7H-benzimidazolo[1,2-a]quinoline-6-carboxylate?
The canonical SMILES for ethyl 5-oxo-7H-benzimidazolo[1,2-a]quinoline-6-carboxylate is CCOC(=O)c1c(=O)c2ccccc2n2c1[nH]c1ccccc12.
What is the InChIKey of ethyl 5-oxo-7H-benzimidazolo[1,2-a]quinoline-6-carboxylate?
The InChIKey is HGYRCYKLLSGOBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N2O3/c1-2-23-18(22)15-16(21)11-7-3-5-9-13(11)20-14-10-6-4-8-12(14)19-17(15)20/h3-10,19H,2H2,1H3.
What are the key properties of ethyl 5-oxo-7H-benzimidazolo[1,2-a]quinoline-6-carboxylate?
ethyl 5-oxo-7H-benzimidazolo[1,2-a]quinoline-6-carboxylate has a molecular weight of 306.32 g/mol, XLogP of 3.11, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-oxo-7H-benzimidazolo[1,2-a]quinoline-6-carboxylate is sourced from PubChem (CID 122523532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).