C34H36N4O5 — CID 122527879
7-[4-[(2S)-2-[[4-(aminomethyl)cyclohexanecarbonyl]amino]-3-anilino-3-oxopropyl]phenyl]-6-methyl-4-oxo-1H-quinoline-3-carboxylic acid (PubChem CID 122527879) has the molecular formula C34H36N4O5 and a molecular weight of 580.69 g/mol. Its IUPAC name is 7-[4-[(2S)-2-[[4-(aminomethyl)cyclohexanecarbonyl]amino]-3-anilino-3-oxopropyl]phenyl]-6-methyl-4-oxo-1H-quinoline-3-carboxylic acid.
| Compound Name | 7-[4-[(2S)-2-[[4-(aminomethyl)cyclohexanecarbonyl]amino]-3-anilino-3-oxopropyl]phenyl]-6-methyl-4-oxo-1H-quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 122527879 |
| Molecular Formula | C34H36N4O5 |
| Molecular Weight | 580.69 g/mol |
| Exact Mass | 580.27 |
| IUPAC Name | 7-[4-[(2S)-2-[[4-(aminomethyl)cyclohexanecarbonyl]amino]-3-anilino-3-oxopropyl]phenyl]-6-methyl-4-oxo-1H-quinoline-3-carboxylic acid |
| SMILES | Cc1cc2c(=O)c(C(=O)O)c[nH]c2cc1-c1ccc(C[C@H](NC(=O)C2CCC(CN)CC2)C(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C34H36N4O5/c1-20-15-27-29(36-19-28(31(27)39)34(42)43)17-26(20)23-11-7-21(8-12-23)16-30(33(41)37-25-5-3-2-4-6-25)38-32(40)24-13-9-22(18-35)10-14-24/h2-8,11-12,15,17,19,22,24,30H,9-10,13-14,16,18,35H2,1H3,(H,36,39)(H,37,41)(H,38,40)(H,42,43)/t22?,24?,30-/m0/s1 |
| InChIKey | NSSRMHRINRKCPU-XUOXIDSFSA-N |
| XLogP | 4.63 |
| TPSA | 154.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.69 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |