C35H40N4O4 — CID 122531539
(2S)-N-[5-(1-adamantylmethyl)-1-[(2-methoxynaphthalen-1-yl)methyl]-2,4-dioxo-1,5-benzodiazepin-3-yl]-2-aminopropanamide (PubChem CID 122531539) has the molecular formula C35H40N4O4 and a molecular weight of 580.73 g/mol. Its IUPAC name is (2S)-N-[5-(1-adamantylmethyl)-1-[(2-methoxynaphthalen-1-yl)methyl]-2,4-dioxo-1,5-benzodiazepin-3-yl]-2-aminopropanamide.
| Compound Name | (2S)-N-[5-(1-adamantylmethyl)-1-[(2-methoxynaphthalen-1-yl)methyl]-2,4-dioxo-1,5-benzodiazepin-3-yl]-2-aminopropanamide |
|---|---|
| PubChem CID | 122531539 |
| Molecular Formula | C35H40N4O4 |
| Molecular Weight | 580.73 g/mol |
| Exact Mass | 580.30 |
| IUPAC Name | (2S)-N-[5-(1-adamantylmethyl)-1-[(2-methoxynaphthalen-1-yl)methyl]-2,4-dioxo-1,5-benzodiazepin-3-yl]-2-aminopropanamide |
| SMILES | COc1ccc2ccccc2c1CN1C(=O)C(NC(=O)[C@H](C)N)C(=O)N(CC23CC4CC(CC(C4)C2)C3)c2ccccc21 |
| InChI | InChI=1S/C35H40N4O4/c1-21(36)32(40)37-31-33(41)38(19-27-26-8-4-3-7-25(26)11-12-30(27)43-2)28-9-5-6-10-29(28)39(34(31)42)20-35-16-22-13-23(17-35)15-24(14-22)18-35/h3-12,21-24,31H,13-20,36H2,1-2H3,(H,37,40)/t21-,22?,23?,24?,31?,35?/m0/s1 |
| InChIKey | FLYPMMIOPVMWBS-LWMOJHMESA-N |
| XLogP | 4.78 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.73 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|