C33H33N3O4 — CID 10626176
phenyl N-[1-(1-adamantylmethyl)-2,4-dioxo-5-phenyl-1,5-benzodiazepin-3-yl]carbamate (PubChem CID 10626176) has the molecular formula C33H33N3O4 and a molecular weight of 535.64 g/mol. Its IUPAC name is phenyl N-[1-(1-adamantylmethyl)-2,4-dioxo-5-phenyl-1,5-benzodiazepin-3-yl]carbamate.
| Compound Name | phenyl N-[1-(1-adamantylmethyl)-2,4-dioxo-5-phenyl-1,5-benzodiazepin-3-yl]carbamate |
|---|---|
| PubChem CID | 10626176 |
| Molecular Formula | C33H33N3O4 |
| Molecular Weight | 535.64 g/mol |
| Exact Mass | 535.25 |
| IUPAC Name | phenyl N-[1-(1-adamantylmethyl)-2,4-dioxo-5-phenyl-1,5-benzodiazepin-3-yl]carbamate |
| SMILES | O=C(NC1C(=O)N(CC23CC4CC(CC(C4)C2)C3)c2ccccc2N(c2ccccc2)C1=O)Oc1ccccc1 |
| InChI | InChI=1S/C33H33N3O4/c37-30-29(34-32(39)40-26-11-5-2-6-12-26)31(38)36(25-9-3-1-4-10-25)28-14-8-7-13-27(28)35(30)21-33-18-22-15-23(19-33)17-24(16-22)20-33/h1-14,22-24,29H,15-21H2,(H,34,39) |
| InChIKey | OCQSYLMNKRAPHB-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.64 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|