C39H44N4O6 — CID 10818141
ethyl 4-[3-[[1-(1-adamantylmethyl)-2,4-dioxo-5-phenyl-1,5-benzodiazepin-3-yl]carbamoylamino]phenoxy]butanoate (PubChem CID 10818141) has the molecular formula C39H44N4O6 and a molecular weight of 664.80 g/mol. Its IUPAC name is ethyl 4-[3-[[1-(1-adamantylmethyl)-2,4-dioxo-5-phenyl-1,5-benzodiazepin-3-yl]carbamoylamino]phenoxy]butanoate.
| Compound Name | ethyl 4-[3-[[1-(1-adamantylmethyl)-2,4-dioxo-5-phenyl-1,5-benzodiazepin-3-yl]carbamoylamino]phenoxy]butanoate |
|---|---|
| PubChem CID | 10818141 |
| Molecular Formula | C39H44N4O6 |
| Molecular Weight | 664.80 g/mol |
| Exact Mass | 664.33 |
| IUPAC Name | ethyl 4-[3-[[1-(1-adamantylmethyl)-2,4-dioxo-5-phenyl-1,5-benzodiazepin-3-yl]carbamoylamino]phenoxy]butanoate |
| SMILES | CCOC(=O)CCCOc1cccc(NC(=O)NC2C(=O)N(CC34CC5CC(CC(C5)C3)C4)c3ccccc3N(c3ccccc3)C2=O)c1 |
| InChI | InChI=1S/C39H44N4O6/c1-2-48-34(44)16-9-17-49-31-13-8-10-29(21-31)40-38(47)41-35-36(45)42(25-39-22-26-18-27(23-39)20-28(19-26)24-39)32-14-6-7-15-33(32)43(37(35)46)30-11-4-3-5-12-30/h3-8,10-15,21,26-28,35H,2,9,16-20,22-25H2,1H3,(H2,40,41,47) |
| InChIKey | QFZJEDOCKUUEKE-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.80 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|