C29H30N4O7 — CID 57174346
methyl 2-[3-[[1,5-bis(2-cyclopropyl-2-oxoethyl)-2,4-dioxo-1,5-benzodiazepin-3-yl]carbamoylamino]phenyl]acetate (PubChem CID 57174346) has the molecular formula C29H30N4O7 and a molecular weight of 546.58 g/mol. Its IUPAC name is methyl 2-[3-[[1,5-bis(2-cyclopropyl-2-oxoethyl)-2,4-dioxo-1,5-benzodiazepin-3-yl]carbamoylamino]phenyl]acetate.
| Compound Name | methyl 2-[3-[[1,5-bis(2-cyclopropyl-2-oxoethyl)-2,4-dioxo-1,5-benzodiazepin-3-yl]carbamoylamino]phenyl]acetate |
|---|---|
| PubChem CID | 57174346 |
| Molecular Formula | C29H30N4O7 |
| Molecular Weight | 546.58 g/mol |
| Exact Mass | 546.21 |
| IUPAC Name | methyl 2-[3-[[1,5-bis(2-cyclopropyl-2-oxoethyl)-2,4-dioxo-1,5-benzodiazepin-3-yl]carbamoylamino]phenyl]acetate |
| SMILES | COC(=O)Cc1cccc(NC(=O)NC2C(=O)N(CC(=O)C3CC3)c3ccccc3N(CC(=O)C3CC3)C2=O)c1 |
| InChI | InChI=1S/C29H30N4O7/c1-40-25(36)14-17-5-4-6-20(13-17)30-29(39)31-26-27(37)32(15-23(34)18-9-10-18)21-7-2-3-8-22(21)33(28(26)38)16-24(35)19-11-12-19/h2-8,13,18-19,26H,9-12,14-16H2,1H3,(H2,30,31,39) |
| InChIKey | WCWGXTHPDQMVJX-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 142.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.58 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|