C32H29N5O4 — CID 10530646
2-[2,4-dioxo-5-phenyl-3-(phenylcarbamoylamino)-1,5-benzodiazepin-1-yl]-N-ethyl-N-phenylacetamide (PubChem CID 10530646) has the molecular formula C32H29N5O4 and a molecular weight of 547.62 g/mol. Its IUPAC name is 2-[2,4-dioxo-5-phenyl-3-(phenylcarbamoylamino)-1,5-benzodiazepin-1-yl]-N-ethyl-N-phenylacetamide.
| Compound Name | 2-[2,4-dioxo-5-phenyl-3-(phenylcarbamoylamino)-1,5-benzodiazepin-1-yl]-N-ethyl-N-phenylacetamide |
|---|---|
| PubChem CID | 10530646 |
| Molecular Formula | C32H29N5O4 |
| Molecular Weight | 547.62 g/mol |
| Exact Mass | 547.22 |
| IUPAC Name | 2-[2,4-dioxo-5-phenyl-3-(phenylcarbamoylamino)-1,5-benzodiazepin-1-yl]-N-ethyl-N-phenylacetamide |
| SMILES | CCN(C(=O)CN1C(=O)C(NC(=O)Nc2ccccc2)C(=O)N(c2ccccc2)c2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C32H29N5O4/c1-2-35(24-16-8-4-9-17-24)28(38)22-36-26-20-12-13-21-27(26)37(25-18-10-5-11-19-25)31(40)29(30(36)39)34-32(41)33-23-14-6-3-7-15-23/h3-21,29H,2,22H2,1H3,(H2,33,34,41) |
| InChIKey | WRDIHBDCUJIVMO-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.62 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|