C30H32N4O3 — CID 10696600
1-[5-(1-cyclopentylpropan-2-yl)-2,4-dioxo-1-phenyl-1,5-benzodiazepin-3-yl]-3-phenylurea (PubChem CID 10696600) has the molecular formula C30H32N4O3 and a molecular weight of 496.61 g/mol. Its IUPAC name is 1-[5-(1-cyclopentylpropan-2-yl)-2,4-dioxo-1-phenyl-1,5-benzodiazepin-3-yl]-3-phenylurea.
| Compound Name | 1-[5-(1-cyclopentylpropan-2-yl)-2,4-dioxo-1-phenyl-1,5-benzodiazepin-3-yl]-3-phenylurea |
|---|---|
| PubChem CID | 10696600 |
| Molecular Formula | C30H32N4O3 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.25 |
| IUPAC Name | 1-[5-(1-cyclopentylpropan-2-yl)-2,4-dioxo-1-phenyl-1,5-benzodiazepin-3-yl]-3-phenylurea |
| SMILES | CC(CC1CCCC1)N1C(=O)C(NC(=O)Nc2ccccc2)C(=O)N(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C30H32N4O3/c1-21(20-22-12-8-9-13-22)33-25-18-10-11-19-26(25)34(24-16-6-3-7-17-24)29(36)27(28(33)35)32-30(37)31-23-14-4-2-5-15-23/h2-7,10-11,14-19,21-22,27H,8-9,12-13,20H2,1H3,(H2,31,32,37) |
| InChIKey | VARVMURJWDXPOA-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|