C33H34N4O3 — CID 10768658
1-[1-(2-adamantylmethyl)-2,4-dioxo-5-phenyl-1,5-benzodiazepin-3-yl]-3-phenylurea (PubChem CID 10768658) has the molecular formula C33H34N4O3 and a molecular weight of 534.66 g/mol. Its IUPAC name is 1-[1-(2-adamantylmethyl)-2,4-dioxo-5-phenyl-1,5-benzodiazepin-3-yl]-3-phenylurea.
| Compound Name | 1-[1-(2-adamantylmethyl)-2,4-dioxo-5-phenyl-1,5-benzodiazepin-3-yl]-3-phenylurea |
|---|---|
| PubChem CID | 10768658 |
| Molecular Formula | C33H34N4O3 |
| Molecular Weight | 534.66 g/mol |
| Exact Mass | 534.26 |
| IUPAC Name | 1-[1-(2-adamantylmethyl)-2,4-dioxo-5-phenyl-1,5-benzodiazepin-3-yl]-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)NC1C(=O)N(CC2C3CC4CC(C3)CC2C4)c2ccccc2N(c2ccccc2)C1=O |
| InChI | InChI=1S/C33H34N4O3/c38-31-30(35-33(40)34-25-9-3-1-4-10-25)32(39)37(26-11-5-2-6-12-26)29-14-8-7-13-28(29)36(31)20-27-23-16-21-15-22(18-23)19-24(27)17-21/h1-14,21-24,27,30H,15-20H2,(H2,34,35,40) |
| InChIKey | OSPBDIKHWUJZRP-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.66 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|