C33H34N4O4 — CID 10370321
1-[1-(1-adamantylmethyl)-2,4-dioxo-5-phenyl-1,5-benzodiazepin-3-yl]-3-(4-hydroxyphenyl)urea (PubChem CID 10370321) has the molecular formula C33H34N4O4 and a molecular weight of 550.66 g/mol. Its IUPAC name is 1-[1-(1-adamantylmethyl)-2,4-dioxo-5-phenyl-1,5-benzodiazepin-3-yl]-3-(4-hydroxyphenyl)urea.
| Compound Name | 1-[1-(1-adamantylmethyl)-2,4-dioxo-5-phenyl-1,5-benzodiazepin-3-yl]-3-(4-hydroxyphenyl)urea |
|---|---|
| PubChem CID | 10370321 |
| Molecular Formula | C33H34N4O4 |
| Molecular Weight | 550.66 g/mol |
| Exact Mass | 550.26 |
| IUPAC Name | 1-[1-(1-adamantylmethyl)-2,4-dioxo-5-phenyl-1,5-benzodiazepin-3-yl]-3-(4-hydroxyphenyl)urea |
| SMILES | O=C(Nc1ccc(O)cc1)NC1C(=O)N(CC23CC4CC(CC(C4)C2)C3)c2ccccc2N(c2ccccc2)C1=O |
| InChI | InChI=1S/C33H34N4O4/c38-26-12-10-24(11-13-26)34-32(41)35-29-30(39)36(20-33-17-21-14-22(18-33)16-23(15-21)19-33)27-8-4-5-9-28(27)37(31(29)40)25-6-2-1-3-7-25/h1-13,21-23,29,38H,14-20H2,(H2,34,35,41) |
| InChIKey | QCWVVOITFSBPBE-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.66 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|