C29H24N4O7 — CID 54371400
1-[1,5-bis[2-(furan-2-yl)-2-oxoethyl]-2,4-dioxo-1,5-benzodiazepin-3-yl]-3-(3-methylphenyl)urea (PubChem CID 54371400) has the molecular formula C29H24N4O7 and a molecular weight of 540.53 g/mol. Its IUPAC name is 1-[1,5-bis[2-(furan-2-yl)-2-oxoethyl]-2,4-dioxo-1,5-benzodiazepin-3-yl]-3-(3-methylphenyl)urea.
| Compound Name | 1-[1,5-bis[2-(furan-2-yl)-2-oxoethyl]-2,4-dioxo-1,5-benzodiazepin-3-yl]-3-(3-methylphenyl)urea |
|---|---|
| PubChem CID | 54371400 |
| Molecular Formula | C29H24N4O7 |
| Molecular Weight | 540.53 g/mol |
| Exact Mass | 540.16 |
| IUPAC Name | 1-[1,5-bis[2-(furan-2-yl)-2-oxoethyl]-2,4-dioxo-1,5-benzodiazepin-3-yl]-3-(3-methylphenyl)urea |
| SMILES | Cc1cccc(NC(=O)NC2C(=O)N(CC(=O)c3ccco3)c3ccccc3N(CC(=O)c3ccco3)C2=O)c1 |
| InChI | InChI=1S/C29H24N4O7/c1-18-7-4-8-19(15-18)30-29(38)31-26-27(36)32(16-22(34)24-11-5-13-39-24)20-9-2-3-10-21(20)33(28(26)37)17-23(35)25-12-6-14-40-25/h2-15,26H,16-17H2,1H3,(H2,30,31,38) |
| InChIKey | UTLQQBNAINCMFF-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 142.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.53 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|