C29H38N4O4 — CID 19961763
1-[2-methyl-4-oxo-5-[2-oxo-2-(3,3,5,5-tetramethylpiperidin-1-yl)ethyl]-2,3-dihydro-1,5-benzoxazepin-3-yl]-3-(3-methylphenyl)urea (PubChem CID 19961763) has the molecular formula C29H38N4O4 and a molecular weight of 506.65 g/mol. Its IUPAC name is 1-[2-methyl-4-oxo-5-[2-oxo-2-(3,3,5,5-tetramethylpiperidin-1-yl)ethyl]-2,3-dihydro-1,5-benzoxazepin-3-yl]-3-(3-methylphenyl)urea.
| Compound Name | 1-[2-methyl-4-oxo-5-[2-oxo-2-(3,3,5,5-tetramethylpiperidin-1-yl)ethyl]-2,3-dihydro-1,5-benzoxazepin-3-yl]-3-(3-methylphenyl)urea |
|---|---|
| PubChem CID | 19961763 |
| Molecular Formula | C29H38N4O4 |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 506.29 |
| IUPAC Name | 1-[2-methyl-4-oxo-5-[2-oxo-2-(3,3,5,5-tetramethylpiperidin-1-yl)ethyl]-2,3-dihydro-1,5-benzoxazepin-3-yl]-3-(3-methylphenyl)urea |
| SMILES | Cc1cccc(NC(=O)NC2C(=O)N(CC(=O)N3CC(C)(C)CC(C)(C)C3)c3ccccc3OC2C)c1 |
| InChI | InChI=1S/C29H38N4O4/c1-19-10-9-11-21(14-19)30-27(36)31-25-20(2)37-23-13-8-7-12-22(23)33(26(25)35)15-24(34)32-17-28(3,4)16-29(5,6)18-32/h7-14,20,25H,15-18H2,1-6H3,(H2,30,31,36) |
| InChIKey | QNXBQFPXAKQGNJ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |