C25H29N5O6 — CID 22871707
1-[(3R)-5-[2-(3,3-dimethylpiperidin-1-yl)-2-oxoethyl]-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]-3-(4-nitrophenyl)urea (PubChem CID 22871707) has the molecular formula C25H29N5O6 and a molecular weight of 495.54 g/mol. Its IUPAC name is 1-[(3R)-5-[2-(3,3-dimethylpiperidin-1-yl)-2-oxoethyl]-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]-3-(4-nitrophenyl)urea.
| Compound Name | 1-[(3R)-5-[2-(3,3-dimethylpiperidin-1-yl)-2-oxoethyl]-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]-3-(4-nitrophenyl)urea |
|---|---|
| PubChem CID | 22871707 |
| Molecular Formula | C25H29N5O6 |
| Molecular Weight | 495.54 g/mol |
| Exact Mass | 495.21 |
| IUPAC Name | 1-[(3R)-5-[2-(3,3-dimethylpiperidin-1-yl)-2-oxoethyl]-4-oxo-2,3-dihydro-1,5-benzoxazepin-3-yl]-3-(4-nitrophenyl)urea |
| SMILES | CC1(C)CCCN(C(=O)CN2C(=O)[C@H](NC(=O)Nc3ccc([N+](=O)[O-])cc3)COc3ccccc32)C1 |
| InChI | InChI=1S/C25H29N5O6/c1-25(2)12-5-13-28(16-25)22(31)14-29-20-6-3-4-7-21(20)36-15-19(23(29)32)27-24(33)26-17-8-10-18(11-9-17)30(34)35/h3-4,6-11,19H,5,12-16H2,1-2H3,(H2,26,27,33)/t19-/m1/s1 |
| InChIKey | RDMILNGHRWZTED-LJQANCHMSA-N |
| XLogP | 3.16 |
| TPSA | 134.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.54 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|