C27H32ClFN4O4 — CID 22871700
1-(3-chlorophenyl)-3-[(3R)-7-fluoro-4-oxo-5-[2-oxo-2-(3,3,5,5-tetramethylpiperidin-1-yl)ethyl]-2,3-dihydro-1,5-benzoxazepin-3-yl]urea (PubChem CID 22871700) has the molecular formula C27H32ClFN4O4 and a molecular weight of 531.03 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[(3R)-7-fluoro-4-oxo-5-[2-oxo-2-(3,3,5,5-tetramethylpiperidin-1-yl)ethyl]-2,3-dihydro-1,5-benzoxazepin-3-yl]urea.
| Compound Name | 1-(3-chlorophenyl)-3-[(3R)-7-fluoro-4-oxo-5-[2-oxo-2-(3,3,5,5-tetramethylpiperidin-1-yl)ethyl]-2,3-dihydro-1,5-benzoxazepin-3-yl]urea |
|---|---|
| PubChem CID | 22871700 |
| Molecular Formula | C27H32ClFN4O4 |
| Molecular Weight | 531.03 g/mol |
| Exact Mass | 530.21 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[(3R)-7-fluoro-4-oxo-5-[2-oxo-2-(3,3,5,5-tetramethylpiperidin-1-yl)ethyl]-2,3-dihydro-1,5-benzoxazepin-3-yl]urea |
| SMILES | CC1(C)CN(C(=O)CN2C(=O)[C@H](NC(=O)Nc3cccc(Cl)c3)COc3ccc(F)cc32)CC(C)(C)C1 |
| InChI | InChI=1S/C27H32ClFN4O4/c1-26(2)14-27(3,4)16-32(15-26)23(34)12-33-21-11-18(29)8-9-22(21)37-13-20(24(33)35)31-25(36)30-19-7-5-6-17(28)10-19/h5-11,20H,12-16H2,1-4H3,(H2,30,31,36)/t20-/m1/s1 |
| InChIKey | JQEJJXBGZAVLMF-HXUWFJFHSA-N |
| XLogP | 4.68 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.03 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |