C33H39N7O9S2 — CID 19070815
methyl 4-[[3-[[2,4-dioxo-1,5-bis[2-oxo-2-(1,3-thiazolidin-2-yl)ethyl]-1,5-benzodiazepin-3-yl]carbamoylamino]phenyl]methoxycarbonylamino]butanoate (PubChem CID 19070815) has the molecular formula C33H39N7O9S2 and a molecular weight of 741.85 g/mol. Its IUPAC name is methyl 4-[[3-[[2,4-dioxo-1,5-bis[2-oxo-2-(1,3-thiazolidin-2-yl)ethyl]-1,5-benzodiazepin-3-yl]carbamoylamino]phenyl]methoxycarbonylamino]butanoate.
| Compound Name | methyl 4-[[3-[[2,4-dioxo-1,5-bis[2-oxo-2-(1,3-thiazolidin-2-yl)ethyl]-1,5-benzodiazepin-3-yl]carbamoylamino]phenyl]methoxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 19070815 |
| Molecular Formula | C33H39N7O9S2 |
| Molecular Weight | 741.85 g/mol |
| Exact Mass | 741.23 |
| IUPAC Name | methyl 4-[[3-[[2,4-dioxo-1,5-bis[2-oxo-2-(1,3-thiazolidin-2-yl)ethyl]-1,5-benzodiazepin-3-yl]carbamoylamino]phenyl]methoxycarbonylamino]butanoate |
| SMILES | COC(=O)CCCNC(=O)OCc1cccc(NC(=O)NC2C(=O)N(CC(=O)C3NCCS3)c3ccccc3N(CC(=O)C3NCCS3)C2=O)c1 |
| InChI | InChI=1S/C33H39N7O9S2/c1-48-26(43)10-5-11-36-33(47)49-19-20-6-4-7-21(16-20)37-32(46)38-27-30(44)39(17-24(41)28-34-12-14-50-28)22-8-2-3-9-23(22)40(31(27)45)18-25(42)29-35-13-15-51-29/h2-4,6-9,16,27-29,34-35H,5,10-15,17-19H2,1H3,(H,36,47)(H2,37,38,46) |
| InChIKey | RJYBXXFPOPIHEQ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 204.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.85 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|