C39H39N9O8 — CID 54052394
4-[[3-[[1,5-bis[1-(1H-imidazol-2-yl)ethyl]-2,4-dioxo-1,5-benzodiazepin-3-yl]carbamoylamino]phenyl]methoxycarbonylamino]butanoyl benzoate (PubChem CID 54052394) has the molecular formula C39H39N9O8 and a molecular weight of 761.80 g/mol. Its IUPAC name is 4-[[3-[[1,5-bis[1-(1H-imidazol-2-yl)ethyl]-2,4-dioxo-1,5-benzodiazepin-3-yl]carbamoylamino]phenyl]methoxycarbonylamino]butanoyl benzoate.
| Compound Name | 4-[[3-[[1,5-bis[1-(1H-imidazol-2-yl)ethyl]-2,4-dioxo-1,5-benzodiazepin-3-yl]carbamoylamino]phenyl]methoxycarbonylamino]butanoyl benzoate |
|---|---|
| PubChem CID | 54052394 |
| Molecular Formula | C39H39N9O8 |
| Molecular Weight | 761.80 g/mol |
| Exact Mass | 761.29 |
| IUPAC Name | 4-[[3-[[1,5-bis[1-(1H-imidazol-2-yl)ethyl]-2,4-dioxo-1,5-benzodiazepin-3-yl]carbamoylamino]phenyl]methoxycarbonylamino]butanoyl benzoate |
| SMILES | CC(c1ncc[nH]1)N1C(=O)C(NC(=O)Nc2cccc(COC(=O)NCCCC(=O)OC(=O)c3ccccc3)c2)C(=O)N(C(C)c2ncc[nH]2)c2ccccc21 |
| InChI | InChI=1S/C39H39N9O8/c1-24(33-40-18-19-41-33)47-29-14-6-7-15-30(29)48(25(2)34-42-20-21-43-34)36(51)32(35(47)50)46-38(53)45-28-13-8-10-26(22-28)23-55-39(54)44-17-9-16-31(49)56-37(52)27-11-4-3-5-12-27/h3-8,10-15,18-22,24-25,32H,9,16-17,23H2,1-2H3,(H,40,41)(H,42,43)(H,44,54)(H2,45,46,53) |
| InChIKey | LTVKFCCUWRXCQF-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 220.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 56 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.80 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|