C14H16N2O5 — CID 19070806
methyl 4-[(3-isocyanatophenyl)methoxycarbonylamino]butanoate (PubChem CID 19070806) has the molecular formula C14H16N2O5 and a molecular weight of 292.29 g/mol. Its IUPAC name is methyl 4-[(3-isocyanatophenyl)methoxycarbonylamino]butanoate.
| Compound Name | methyl 4-[(3-isocyanatophenyl)methoxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 19070806 |
| Molecular Formula | C14H16N2O5 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | methyl 4-[(3-isocyanatophenyl)methoxycarbonylamino]butanoate |
| SMILES | COC(=O)CCCNC(=O)OCc1cccc(N=C=O)c1 |
| InChI | InChI=1S/C14H16N2O5/c1-20-13(18)6-3-7-15-14(19)21-9-11-4-2-5-12(8-11)16-10-17/h2,4-5,8H,3,6-7,9H2,1H3,(H,15,19) |
| InChIKey | GPDLXCSGIDJYQM-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|