C32H35N3O6 — CID 11284360
methyl 2-[4-benzyl-2,5-dioxo-3-[5-(phenylmethoxycarbonylamino)pentyl]-3H-1,4-benzodiazepin-1-yl]acetate (PubChem CID 11284360) has the molecular formula C32H35N3O6 and a molecular weight of 557.65 g/mol. Its IUPAC name is methyl 2-[4-benzyl-2,5-dioxo-3-[5-(phenylmethoxycarbonylamino)pentyl]-3H-1,4-benzodiazepin-1-yl]acetate.
| Compound Name | methyl 2-[4-benzyl-2,5-dioxo-3-[5-(phenylmethoxycarbonylamino)pentyl]-3H-1,4-benzodiazepin-1-yl]acetate |
|---|---|
| PubChem CID | 11284360 |
| Molecular Formula | C32H35N3O6 |
| Molecular Weight | 557.65 g/mol |
| Exact Mass | 557.25 |
| IUPAC Name | methyl 2-[4-benzyl-2,5-dioxo-3-[5-(phenylmethoxycarbonylamino)pentyl]-3H-1,4-benzodiazepin-1-yl]acetate |
| SMILES | COC(=O)CN1C(=O)C(CCCCCNC(=O)OCc2ccccc2)N(Cc2ccccc2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C32H35N3O6/c1-40-29(36)22-35-27-18-11-10-17-26(27)30(37)34(21-24-13-5-2-6-14-24)28(31(35)38)19-9-4-12-20-33-32(39)41-23-25-15-7-3-8-16-25/h2-3,5-8,10-11,13-18,28H,4,9,12,19-23H2,1H3,(H,33,39) |
| InChIKey | YCJUTKIEPNIPMP-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.65 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|