C28H28ClN3O5 — CID 18992998
(3-methoxyphenyl) N-[7-chloro-5-(3-methylbutyl)-2,4-dioxo-1-phenyl-1,5-benzodiazepin-3-yl]carbamate (PubChem CID 18992998) has the molecular formula C28H28ClN3O5 and a molecular weight of 522.00 g/mol. Its IUPAC name is (3-methoxyphenyl) N-[7-chloro-5-(3-methylbutyl)-2,4-dioxo-1-phenyl-1,5-benzodiazepin-3-yl]carbamate.
| Compound Name | (3-methoxyphenyl) N-[7-chloro-5-(3-methylbutyl)-2,4-dioxo-1-phenyl-1,5-benzodiazepin-3-yl]carbamate |
|---|---|
| PubChem CID | 18992998 |
| Molecular Formula | C28H28ClN3O5 |
| Molecular Weight | 522.00 g/mol |
| Exact Mass | 521.17 |
| IUPAC Name | (3-methoxyphenyl) N-[7-chloro-5-(3-methylbutyl)-2,4-dioxo-1-phenyl-1,5-benzodiazepin-3-yl]carbamate |
| SMILES | COc1cccc(OC(=O)NC2C(=O)N(CCC(C)C)c3cc(Cl)ccc3N(c3ccccc3)C2=O)c1 |
| InChI | InChI=1S/C28H28ClN3O5/c1-18(2)14-15-31-24-16-19(29)12-13-23(24)32(20-8-5-4-6-9-20)27(34)25(26(31)33)30-28(35)37-22-11-7-10-21(17-22)36-3/h4-13,16-18,25H,14-15H2,1-3H3,(H,30,35) |
| InChIKey | YXHZIJSFTKQVLG-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.00 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|