C20H23N3O2 — CID 10640683
(3S)-3-amino-1-(3-methylbutyl)-5-phenyl-1,5-benzodiazepine-2,4-dione (PubChem CID 10640683) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is (3S)-3-amino-1-(3-methylbutyl)-5-phenyl-1,5-benzodiazepine-2,4-dione.
| Compound Name | (3S)-3-amino-1-(3-methylbutyl)-5-phenyl-1,5-benzodiazepine-2,4-dione |
|---|---|
| PubChem CID | 10640683 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | (3S)-3-amino-1-(3-methylbutyl)-5-phenyl-1,5-benzodiazepine-2,4-dione |
| SMILES | CC(C)CCN1C(=O)[C@H](N)C(=O)N(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C20H23N3O2/c1-14(2)12-13-22-16-10-6-7-11-17(16)23(15-8-4-3-5-9-15)20(25)18(21)19(22)24/h3-11,14,18H,12-13,21H2,1-2H3/t18-/m0/s1 |
| InChIKey | VGOAJCYZNWXKGR-SFHVURJKSA-N |
| XLogP | 3.07 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|