C19H29N3O2 — CID 22312580
3-amino-1,5-bis(2,2-dimethylpropyl)-1,5-benzodiazepine-2,4-dione (PubChem CID 22312580) has the molecular formula C19H29N3O2 and a molecular weight of 331.46 g/mol. Its IUPAC name is 3-amino-1,5-bis(2,2-dimethylpropyl)-1,5-benzodiazepine-2,4-dione.
| Compound Name | 3-amino-1,5-bis(2,2-dimethylpropyl)-1,5-benzodiazepine-2,4-dione |
|---|---|
| PubChem CID | 22312580 |
| Molecular Formula | C19H29N3O2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | 3-amino-1,5-bis(2,2-dimethylpropyl)-1,5-benzodiazepine-2,4-dione |
| SMILES | CC(C)(C)CN1C(=O)C(N)C(=O)N(CC(C)(C)C)c2ccccc21 |
| InChI | InChI=1S/C19H29N3O2/c1-18(2,3)11-21-13-9-7-8-10-14(13)22(12-19(4,5)6)17(24)15(20)16(21)23/h7-10,15H,11-12,20H2,1-6H3 |
| InChIKey | LUQQKWMUZVLMAI-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|