C20H21N5O2 — CID 10808702
3-azido-1-(3-methylbutyl)-5-phenyl-1,5-benzodiazepine-2,4-dione (PubChem CID 10808702) has the molecular formula C20H21N5O2 and a molecular weight of 363.42 g/mol. Its IUPAC name is 3-azido-1-(3-methylbutyl)-5-phenyl-1,5-benzodiazepine-2,4-dione.
| Compound Name | 3-azido-1-(3-methylbutyl)-5-phenyl-1,5-benzodiazepine-2,4-dione |
|---|---|
| PubChem CID | 10808702 |
| Molecular Formula | C20H21N5O2 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 3-azido-1-(3-methylbutyl)-5-phenyl-1,5-benzodiazepine-2,4-dione |
| SMILES | CC(C)CCN1C(=O)C(N=[N+]=[N-])C(=O)N(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C20H21N5O2/c1-14(2)12-13-24-16-10-6-7-11-17(16)25(15-8-4-3-5-9-15)20(27)18(19(24)26)22-23-21/h3-11,14,18H,12-13H2,1-2H3 |
| InChIKey | AZPSULNOAOXZQI-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 89.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|